C29H45NO5Si — CID 140511057
4-[2-[4-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]phenyl]ethenyl]-N-methylaniline (PubChem CID 140511057) has the molecular formula C29H45NO5Si and a molecular weight of 515.77 g/mol. Its IUPAC name is 4-[2-[4-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]phenyl]ethenyl]-N-methylaniline.
| Compound Name | 4-[2-[4-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]phenyl]ethenyl]-N-methylaniline |
|---|---|
| PubChem CID | 140511057 |
| Molecular Formula | C29H45NO5Si |
| Molecular Weight | 515.77 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | 4-[2-[4-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]phenyl]ethenyl]-N-methylaniline |
| SMILES | CNc1ccc(C=Cc2ccc(OCCOCCOCCOCCO[Si](C)(C)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H45NO5Si/c1-29(2,3)36(5,6)35-24-22-33-20-18-31-17-19-32-21-23-34-28-15-11-26(12-16-28)8-7-25-9-13-27(30-4)14-10-25/h7-16,30H,17-24H2,1-6H3 |
| InChIKey | COKRQMZOUOWODZ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.77 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|