C27H34INO4 — CID 11649856
4-[(1E,3E,5E)-6-[4-[2-[2-[2-(2-(131I)iodoethoxy)ethoxy]ethoxy]ethoxy]phenyl]hexa-1,3,5-trienyl]-N-methyl(131I)aniline (PubChem CID 11649856) has the molecular formula C27H34INO4 and a molecular weight of 567.48 g/mol. Its IUPAC name is 4-[(1E,3E,5E)-6-[4-[2-[2-[2-(2-(131I)iodoethoxy)ethoxy]ethoxy]ethoxy]phenyl]hexa-1,3,5-trienyl]-N-methyl(131I)aniline.
| Compound Name | 4-[(1E,3E,5E)-6-[4-[2-[2-[2-(2-(131I)iodoethoxy)ethoxy]ethoxy]ethoxy]phenyl]hexa-1,3,5-trienyl]-N-methyl(131I)aniline |
|---|---|
| PubChem CID | 11649856 |
| Molecular Formula | C27H34INO4 |
| Molecular Weight | 567.48 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | 4-[(1E,3E,5E)-6-[4-[2-[2-[2-(2-(131I)iodoethoxy)ethoxy]ethoxy]ethoxy]phenyl]hexa-1,3,5-trienyl]-N-methyl(131I)aniline |
| SMILES | CNc1ccc(/C=C/C=C/C=C/c2ccc(OCCOCCOCCOCC[131I])cc2)cc1 |
| InChI | InChI=1S/C27H34INO4/c1-29-26-12-8-24(9-13-26)6-4-2-3-5-7-25-10-14-27(15-11-25)33-23-22-32-21-20-31-19-18-30-17-16-28/h2-15,29H,16-23H2,1H3/b3-2+,6-4+,7-5+/i28+4 |
| InChIKey | SWLWGRQADZAIJZ-RLAHTXLBSA-N |
| XLogP | 5.87 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|