C20H33NO6 — CID 134493052
3-methyl-1-[2-[2-[2-[2-[4-(methylamino)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]butan-2-one (PubChem CID 134493052) has the molecular formula C20H33NO6 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-methyl-1-[2-[2-[2-[2-[4-(methylamino)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]butan-2-one.
| Compound Name | 3-methyl-1-[2-[2-[2-[2-[4-(methylamino)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]butan-2-one |
|---|---|
| PubChem CID | 134493052 |
| Molecular Formula | C20H33NO6 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 3-methyl-1-[2-[2-[2-[2-[4-(methylamino)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]butan-2-one |
| SMILES | CNc1ccc(OCCOCCOCCOCCOCC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C20H33NO6/c1-17(2)20(22)16-26-13-12-24-9-8-23-10-11-25-14-15-27-19-6-4-18(21-3)5-7-19/h4-7,17,21H,8-16H2,1-3H3 |
| InChIKey | VNOWMFCNMYNVHY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|