C20H33NO4S — CID 135216857
3-methyl-1-[4-[3-[4-(1-sulfanylethylamino)phenoxy]propoxy]butoxy]butan-2-one (PubChem CID 135216857) has the molecular formula C20H33NO4S and a molecular weight of 383.55 g/mol. Its IUPAC name is 3-methyl-1-[4-[3-[4-(1-sulfanylethylamino)phenoxy]propoxy]butoxy]butan-2-one.
| Compound Name | 3-methyl-1-[4-[3-[4-(1-sulfanylethylamino)phenoxy]propoxy]butoxy]butan-2-one |
|---|---|
| PubChem CID | 135216857 |
| Molecular Formula | C20H33NO4S |
| Molecular Weight | 383.55 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 3-methyl-1-[4-[3-[4-(1-sulfanylethylamino)phenoxy]propoxy]butoxy]butan-2-one |
| SMILES | CC(S)Nc1ccc(OCCCOCCCCOCC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C20H33NO4S/c1-16(2)20(22)15-24-12-5-4-11-23-13-6-14-25-19-9-7-18(8-10-19)21-17(3)26/h7-10,16-17,21,26H,4-6,11-15H2,1-3H3 |
| InChIKey | FQKRJTCGHNXKTE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|