C19H31NO4 — CID 126654789
3-methyl-1-[3-[2-[3-(propan-2-ylamino)phenoxy]ethoxy]propoxy]butan-2-one (PubChem CID 126654789) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is 3-methyl-1-[3-[2-[3-(propan-2-ylamino)phenoxy]ethoxy]propoxy]butan-2-one.
| Compound Name | 3-methyl-1-[3-[2-[3-(propan-2-ylamino)phenoxy]ethoxy]propoxy]butan-2-one |
|---|---|
| PubChem CID | 126654789 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 3-methyl-1-[3-[2-[3-(propan-2-ylamino)phenoxy]ethoxy]propoxy]butan-2-one |
| SMILES | CC(C)Nc1cccc(OCCOCCCOCC(=O)C(C)C)c1 |
| InChI | InChI=1S/C19H31NO4/c1-15(2)19(21)14-23-10-6-9-22-11-12-24-18-8-5-7-17(13-18)20-16(3)4/h5,7-8,13,15-16,20H,6,9-12,14H2,1-4H3 |
| InChIKey | WUUZLIJJUUFOAV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|