C19H31NO4S — CID 135174884
3-methyl-1-[3-[3-[4-(1-sulfanylethylamino)phenoxy]propoxy]propoxy]butan-2-one (PubChem CID 135174884) has the molecular formula C19H31NO4S and a molecular weight of 369.53 g/mol. Its IUPAC name is 3-methyl-1-[3-[3-[4-(1-sulfanylethylamino)phenoxy]propoxy]propoxy]butan-2-one.
| Compound Name | 3-methyl-1-[3-[3-[4-(1-sulfanylethylamino)phenoxy]propoxy]propoxy]butan-2-one |
|---|---|
| PubChem CID | 135174884 |
| Molecular Formula | C19H31NO4S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 3-methyl-1-[3-[3-[4-(1-sulfanylethylamino)phenoxy]propoxy]propoxy]butan-2-one |
| SMILES | CC(S)Nc1ccc(OCCCOCCCOCC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C19H31NO4S/c1-15(2)19(21)14-23-12-4-10-22-11-5-13-24-18-8-6-17(7-9-18)20-16(3)25/h6-9,15-16,20,25H,4-5,10-14H2,1-3H3 |
| InChIKey | UFMZGSDKWAPABL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|