C21H33NO4S — CID 138656847
1-[3-[3-[4-[1-(1-sulfanylethylamino)cyclopropyl]phenoxy]propoxy]propoxy]butan-2-one (PubChem CID 138656847) has the molecular formula C21H33NO4S and a molecular weight of 395.57 g/mol. Its IUPAC name is 1-[3-[3-[4-[1-(1-sulfanylethylamino)cyclopropyl]phenoxy]propoxy]propoxy]butan-2-one.
| Compound Name | 1-[3-[3-[4-[1-(1-sulfanylethylamino)cyclopropyl]phenoxy]propoxy]propoxy]butan-2-one |
|---|---|
| PubChem CID | 138656847 |
| Molecular Formula | C21H33NO4S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 1-[3-[3-[4-[1-(1-sulfanylethylamino)cyclopropyl]phenoxy]propoxy]propoxy]butan-2-one |
| SMILES | CCC(=O)COCCCOCCCOc1ccc(C2(NC(C)S)CC2)cc1 |
| InChI | InChI=1S/C21H33NO4S/c1-3-19(23)16-25-14-4-12-24-13-5-15-26-20-8-6-18(7-9-20)21(10-11-21)22-17(2)27/h6-9,17,22,27H,3-5,10-16H2,1-2H3 |
| InChIKey | WDOFEGTUALQFRP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|