C19H31NO5 — CID 164592816
methyl 2-[3-[5-[4-[(1S)-1-aminoethyl]phenoxy]pentoxy]propoxy]acetate (PubChem CID 164592816) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is methyl 2-[3-[5-[4-[(1S)-1-aminoethyl]phenoxy]pentoxy]propoxy]acetate.
| Compound Name | methyl 2-[3-[5-[4-[(1S)-1-aminoethyl]phenoxy]pentoxy]propoxy]acetate |
|---|---|
| PubChem CID | 164592816 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | methyl 2-[3-[5-[4-[(1S)-1-aminoethyl]phenoxy]pentoxy]propoxy]acetate |
| SMILES | COC(=O)COCCCOCCCCCOc1ccc([C@H](C)N)cc1 |
| InChI | InChI=1S/C19H31NO5/c1-16(20)17-7-9-18(10-8-17)25-14-5-3-4-11-23-12-6-13-24-15-19(21)22-2/h7-10,16H,3-6,11-15,20H2,1-2H3/t16-/m0/s1 |
| InChIKey | QCCBAJYWYHBOKF-INIZCTEOSA-N |
| XLogP | 2.85 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|