C25H42FNO6 — CID 164592691
methyl 6-[2-[2-[6-[3-[(1R)-1-aminoethyl]-4-fluorophenoxy]hexoxy]ethoxy]ethoxy]hexanoate (PubChem CID 164592691) has the molecular formula C25H42FNO6 and a molecular weight of 471.61 g/mol. Its IUPAC name is methyl 6-[2-[2-[6-[3-[(1R)-1-aminoethyl]-4-fluorophenoxy]hexoxy]ethoxy]ethoxy]hexanoate.
| Compound Name | methyl 6-[2-[2-[6-[3-[(1R)-1-aminoethyl]-4-fluorophenoxy]hexoxy]ethoxy]ethoxy]hexanoate |
|---|---|
| PubChem CID | 164592691 |
| Molecular Formula | C25H42FNO6 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | methyl 6-[2-[2-[6-[3-[(1R)-1-aminoethyl]-4-fluorophenoxy]hexoxy]ethoxy]ethoxy]hexanoate |
| SMILES | COC(=O)CCCCCOCCOCCOCCCCCCOc1ccc(F)c([C@@H](C)N)c1 |
| InChI | InChI=1S/C25H42FNO6/c1-21(27)23-20-22(11-12-24(23)26)33-15-9-4-3-7-13-30-16-18-32-19-17-31-14-8-5-6-10-25(28)29-2/h11-12,20-21H,3-10,13-19,27H2,1-2H3/t21-/m1/s1 |
| InChIKey | FVKAZYRLXHAMLI-OAQYLSRUSA-N |
| XLogP | 4.57 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|