C16H23FO3 — CID 59134665
methyl 6-(2-fluoro-5-propan-2-ylphenoxy)hexanoate (PubChem CID 59134665) has the molecular formula C16H23FO3 and a molecular weight of 282.36 g/mol. Its IUPAC name is methyl 6-(2-fluoro-5-propan-2-ylphenoxy)hexanoate.
| Compound Name | methyl 6-(2-fluoro-5-propan-2-ylphenoxy)hexanoate |
|---|---|
| PubChem CID | 59134665 |
| Molecular Formula | C16H23FO3 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | methyl 6-(2-fluoro-5-propan-2-ylphenoxy)hexanoate |
| SMILES | COC(=O)CCCCCOc1cc(C(C)C)ccc1F |
| InChI | InChI=1S/C16H23FO3/c1-12(2)13-8-9-14(17)15(11-13)20-10-6-4-5-7-16(18)19-3/h8-9,11-12H,4-7,10H2,1-3H3 |
| InChIKey | JXLJJIUQNOSERZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|