C20H28I2O6 — CID 102442509
methyl 6-[2,5-diiodo-4-(6-methoxy-6-oxohexoxy)phenoxy]hexanoate (PubChem CID 102442509) has the molecular formula C20H28I2O6 and a molecular weight of 618.25 g/mol. Its IUPAC name is methyl 6-[2,5-diiodo-4-(6-methoxy-6-oxohexoxy)phenoxy]hexanoate.
| Compound Name | methyl 6-[2,5-diiodo-4-(6-methoxy-6-oxohexoxy)phenoxy]hexanoate |
|---|---|
| PubChem CID | 102442509 |
| Molecular Formula | C20H28I2O6 |
| Molecular Weight | 618.25 g/mol |
| Exact Mass | 618.00 |
| IUPAC Name | methyl 6-[2,5-diiodo-4-(6-methoxy-6-oxohexoxy)phenoxy]hexanoate |
| SMILES | COC(=O)CCCCCOc1cc(I)c(OCCCCCC(=O)OC)cc1I |
| InChI | InChI=1S/C20H28I2O6/c1-25-19(23)9-5-3-7-11-27-17-13-16(22)18(14-15(17)21)28-12-8-4-6-10-20(24)26-2/h13-14H,3-12H2,1-2H3 |
| InChIKey | YBEFCERIHCPYEN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.25 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|