C22H36INO3 — CID 139913826
N-(2,5-diheptoxy-4-iodophenyl)acetamide (PubChem CID 139913826) has the molecular formula C22H36INO3 and a molecular weight of 489.44 g/mol. Its IUPAC name is N-(2,5-diheptoxy-4-iodophenyl)acetamide.
| Compound Name | N-(2,5-diheptoxy-4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 139913826 |
| Molecular Formula | C22H36INO3 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-(2,5-diheptoxy-4-iodophenyl)acetamide |
| SMILES | CCCCCCCOc1cc(NC(C)=O)c(OCCCCCCC)cc1I |
| InChI | InChI=1S/C22H36INO3/c1-4-6-8-10-12-14-26-21-17-20(24-18(3)25)22(16-19(21)23)27-15-13-11-9-7-5-2/h16-17H,4-15H2,1-3H3,(H,24,25) |
| InChIKey | QWDYZSRBYMSDSZ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|