C25H41N3O2S — CID 10456287
N-(3-butyl-2-butylimino-5-octoxy-1,3-benzothiazol-6-yl)acetamide (PubChem CID 10456287) has the molecular formula C25H41N3O2S and a molecular weight of 447.69 g/mol. Its IUPAC name is N-(3-butyl-2-butylimino-5-octoxy-1,3-benzothiazol-6-yl)acetamide.
| Compound Name | N-(3-butyl-2-butylimino-5-octoxy-1,3-benzothiazol-6-yl)acetamide |
|---|---|
| PubChem CID | 10456287 |
| Molecular Formula | C25H41N3O2S |
| Molecular Weight | 447.69 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | N-(3-butyl-2-butylimino-5-octoxy-1,3-benzothiazol-6-yl)acetamide |
| SMILES | CCCCCCCCOc1cc2c(cc1NC(C)=O)s/c(=N\CCCC)n2CCCC |
| InChI | InChI=1S/C25H41N3O2S/c1-5-8-11-12-13-14-17-30-23-19-22-24(18-21(23)27-20(4)29)31-25(26-15-9-6-2)28(22)16-10-7-3/h18-19H,5-17H2,1-4H3,(H,27,29)/b26-25- |
| InChIKey | URVUZKQGBZPMMZ-QPLCGJKRSA-N |
| XLogP | 6.90 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.69 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|