C28H38ClN3O2S — CID 21022266
N-[2-butylimino-3-[(4-chlorophenyl)methyl]-5-octoxy-1,3-benzothiazol-6-yl]acetamide (PubChem CID 21022266) has the molecular formula C28H38ClN3O2S and a molecular weight of 516.15 g/mol. Its IUPAC name is N-[2-butylimino-3-[(4-chlorophenyl)methyl]-5-octoxy-1,3-benzothiazol-6-yl]acetamide.
| Compound Name | N-[2-butylimino-3-[(4-chlorophenyl)methyl]-5-octoxy-1,3-benzothiazol-6-yl]acetamide |
|---|---|
| PubChem CID | 21022266 |
| Molecular Formula | C28H38ClN3O2S |
| Molecular Weight | 516.15 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | N-[2-butylimino-3-[(4-chlorophenyl)methyl]-5-octoxy-1,3-benzothiazol-6-yl]acetamide |
| SMILES | CCCCCCCCOc1cc2c(cc1NC(C)=O)s/c(=N\CCCC)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H38ClN3O2S/c1-4-6-8-9-10-11-17-34-26-19-25-27(18-24(26)31-21(3)33)35-28(30-16-7-5-2)32(25)20-22-12-14-23(29)15-13-22/h12-15,18-19H,4-11,16-17,20H2,1-3H3,(H,31,33)/b30-28- |
| InChIKey | ZRASXBVLJURROU-HYOGKJQXSA-N |
| XLogP | 7.80 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.15 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|