C31H37N3O2S — CID 21022268
N-[3-benzyl-2-phenylimino-5-(3,5,5-trimethylhexoxy)-1,3-benzothiazol-6-yl]acetamide (PubChem CID 21022268) has the molecular formula C31H37N3O2S and a molecular weight of 515.72 g/mol. Its IUPAC name is N-[3-benzyl-2-phenylimino-5-(3,5,5-trimethylhexoxy)-1,3-benzothiazol-6-yl]acetamide.
| Compound Name | N-[3-benzyl-2-phenylimino-5-(3,5,5-trimethylhexoxy)-1,3-benzothiazol-6-yl]acetamide |
|---|---|
| PubChem CID | 21022268 |
| Molecular Formula | C31H37N3O2S |
| Molecular Weight | 515.72 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | N-[3-benzyl-2-phenylimino-5-(3,5,5-trimethylhexoxy)-1,3-benzothiazol-6-yl]acetamide |
| SMILES | CC(=O)Nc1cc2s/c(=N\c3ccccc3)n(Cc3ccccc3)c2cc1OCCC(C)CC(C)(C)C |
| InChI | InChI=1S/C31H37N3O2S/c1-22(20-31(3,4)5)16-17-36-28-19-27-29(18-26(28)32-23(2)35)37-30(33-25-14-10-7-11-15-25)34(27)21-24-12-8-6-9-13-24/h6-15,18-19,22H,16-17,20-21H2,1-5H3,(H,32,35)/b33-30- |
| InChIKey | MZQBPJJITFPNHU-MEIHLTSWSA-N |
| XLogP | 7.78 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.72 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |