C17H17BrN2S — CID 45125354
3-benzyl-4-methyl-N-phenyl-1,3-thiazol-2-imine;hydrobromide (PubChem CID 45125354) has the molecular formula C17H17BrN2S and a molecular weight of 361.31 g/mol. Its IUPAC name is 3-benzyl-4-methyl-N-phenyl-1,3-thiazol-2-imine;hydrobromide.
| Compound Name | 3-benzyl-4-methyl-N-phenyl-1,3-thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 45125354 |
| Molecular Formula | C17H17BrN2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 3-benzyl-4-methyl-N-phenyl-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.Cc1cs/c(=N\c2ccccc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C17H16N2S.BrH/c1-14-13-20-17(18-16-10-6-3-7-11-16)19(14)12-15-8-4-2-5-9-15;/h2-11,13H,12H2,1H3;1H/b18-17-; |
| InChIKey | WGPXYUHJQLBFFU-YBFBCAGJSA-N |
| XLogP | 4.72 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|