C24H23BrN2OS — CID 163332770
3-benzyl-N-(4-methoxyphenyl)-4-(4-methylphenyl)-1,3-thiazol-2-imine;hydrobromide (PubChem CID 163332770) has the molecular formula C24H23BrN2OS and a molecular weight of 467.43 g/mol. Its IUPAC name is 3-benzyl-N-(4-methoxyphenyl)-4-(4-methylphenyl)-1,3-thiazol-2-imine;hydrobromide.
| Compound Name | 3-benzyl-N-(4-methoxyphenyl)-4-(4-methylphenyl)-1,3-thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 163332770 |
| Molecular Formula | C24H23BrN2OS |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 3-benzyl-N-(4-methoxyphenyl)-4-(4-methylphenyl)-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.COc1ccc(/N=c2\scc(-c3ccc(C)cc3)n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2OS.BrH/c1-18-8-10-20(11-9-18)23-17-28-24(25-21-12-14-22(27-2)15-13-21)26(23)16-19-6-4-3-5-7-19;/h3-15,17H,16H2,1-2H3;1H/b25-24-; |
| InChIKey | ZEEUBUMCHXESQI-BJFQDICYSA-N |
| XLogP | 6.39 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|