C18H17BrClN2O2S- — CID 21178881
2-[4-(4-chlorophenyl)-2-(4-methoxyphenyl)imino-1,3-thiazol-3-yl]ethanol bromide (PubChem CID 21178881) has the molecular formula C18H17BrClN2O2S- and a molecular weight of 440.77 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-2-(4-methoxyphenyl)imino-1,3-thiazol-3-yl]ethanol bromide.
| Compound Name | 2-[4-(4-chlorophenyl)-2-(4-methoxyphenyl)imino-1,3-thiazol-3-yl]ethanol bromide |
|---|---|
| PubChem CID | 21178881 |
| Molecular Formula | C18H17BrClN2O2S- |
| Molecular Weight | 440.77 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-2-(4-methoxyphenyl)imino-1,3-thiazol-3-yl]ethanol bromide |
| SMILES | COc1ccc(/N=c2\scc(-c3ccc(Cl)cc3)n2CCO)cc1.[Br-] |
| InChI | InChI=1S/C18H17ClN2O2S.BrH/c1-23-16-8-6-15(7-9-16)20-18-21(10-11-22)17(12-24-18)13-2-4-14(19)5-3-13;/h2-9,12,22H,10-11H2,1H3;1H/p-1/b20-18-; |
| InChIKey | GYHCLXUAWZYIOX-GQQUDWLYSA-M |
| XLogP | 1.11 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.77 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|