C22H25N3O5S2 — CID 3665554
2-[2-(4-methoxyphenyl)imino-4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-3-yl]ethanol (PubChem CID 3665554) has the molecular formula C22H25N3O5S2 and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)imino-4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-3-yl]ethanol.
| Compound Name | 2-[2-(4-methoxyphenyl)imino-4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 3665554 |
| Molecular Formula | C22H25N3O5S2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)imino-4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-3-yl]ethanol |
| SMILES | COc1ccc(/N=c2\scc(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)n2CCO)cc1 |
| InChI | InChI=1S/C22H25N3O5S2/c1-29-19-6-4-18(5-7-19)23-22-25(10-13-26)21(16-31-22)17-2-8-20(9-3-17)32(27,28)24-11-14-30-15-12-24/h2-9,16,26H,10-15H2,1H3/b23-22- |
| InChIKey | CNFQRORFXHANBQ-FCQUAONHSA-N |
| XLogP | 2.47 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|