C29H38N4O4S2 — CID 18812836
4-[4-(azepan-1-ylsulfonyl)phenyl]-N-(4-methoxyphenyl)-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine (PubChem CID 18812836) has the molecular formula C29H38N4O4S2 and a molecular weight of 570.78 g/mol. Its IUPAC name is 4-[4-(azepan-1-ylsulfonyl)phenyl]-N-(4-methoxyphenyl)-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine.
| Compound Name | 4-[4-(azepan-1-ylsulfonyl)phenyl]-N-(4-methoxyphenyl)-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 18812836 |
| Molecular Formula | C29H38N4O4S2 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | 4-[4-(azepan-1-ylsulfonyl)phenyl]-N-(4-methoxyphenyl)-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(/N=c2\scc(-c3ccc(S(=O)(=O)N4CCCCCC4)cc3)n2CCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C29H38N4O4S2/c1-36-26-11-9-25(10-12-26)30-29-33(18-6-15-31-19-21-37-22-20-31)28(23-38-29)24-7-13-27(14-8-24)39(34,35)32-16-4-2-3-5-17-32/h7-14,23H,2-6,15-22H2,1H3/b30-29- |
| InChIKey | YNIOOCNQNYCCAG-FLWNBWAVSA-N |
| XLogP | 4.74 |
| TPSA | 76.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|