C34H40N4O3S2 — CID 5120876
4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-(3-morpholin-4-ylpropyl)-N-phenyl-1,3-thiazol-2-imine (PubChem CID 5120876) has the molecular formula C34H40N4O3S2 and a molecular weight of 616.85 g/mol. Its IUPAC name is 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-(3-morpholin-4-ylpropyl)-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-(3-morpholin-4-ylpropyl)-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 5120876 |
| Molecular Formula | C34H40N4O3S2 |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | 4-[4-(4-benzylpiperidin-1-yl)sulfonylphenyl]-3-(3-morpholin-4-ylpropyl)-N-phenyl-1,3-thiazol-2-imine |
| SMILES | O=S(=O)(c1ccc(-c2cs/c(=N\c3ccccc3)n2CCCN2CCOCC2)cc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C34H40N4O3S2/c39-43(40,37-20-16-29(17-21-37)26-28-8-3-1-4-9-28)32-14-12-30(13-15-32)33-27-42-34(35-31-10-5-2-6-11-31)38(33)19-7-18-36-22-24-41-25-23-36/h1-6,8-15,27,29H,7,16-26H2/b35-34- |
| InChIKey | HOAJXZNUHXUTQU-KNWKATPGSA-N |
| XLogP | 5.81 |
| TPSA | 67.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|