C25H31N3O3S2 — CID 3492123
6-[2-phenylimino-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-3-yl]hexan-1-ol (PubChem CID 3492123) has the molecular formula C25H31N3O3S2 and a molecular weight of 485.68 g/mol. Its IUPAC name is 6-[2-phenylimino-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-3-yl]hexan-1-ol.
| Compound Name | 6-[2-phenylimino-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-3-yl]hexan-1-ol |
|---|---|
| PubChem CID | 3492123 |
| Molecular Formula | C25H31N3O3S2 |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 6-[2-phenylimino-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazol-3-yl]hexan-1-ol |
| SMILES | O=S(=O)(c1ccc(-c2cs/c(=N\c3ccccc3)n2CCCCCCO)cc1)N1CCCC1 |
| InChI | InChI=1S/C25H31N3O3S2/c29-19-9-2-1-6-18-28-24(20-32-25(28)26-22-10-4-3-5-11-22)21-12-14-23(15-13-21)33(30,31)27-16-7-8-17-27/h3-5,10-15,20,29H,1-2,6-9,16-19H2/b26-25- |
| InChIKey | KHDVEYQTWBZVHJ-QPLCGJKRSA-N |
| XLogP | 4.79 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|