C26H33N3O2S2 — CID 4701319
4-[3-(azepan-1-ylsulfonyl)phenyl]-3-pentyl-N-phenyl-1,3-thiazol-2-imine (PubChem CID 4701319) has the molecular formula C26H33N3O2S2 and a molecular weight of 483.70 g/mol. Its IUPAC name is 4-[3-(azepan-1-ylsulfonyl)phenyl]-3-pentyl-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 4-[3-(azepan-1-ylsulfonyl)phenyl]-3-pentyl-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4701319 |
| Molecular Formula | C26H33N3O2S2 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 4-[3-(azepan-1-ylsulfonyl)phenyl]-3-pentyl-N-phenyl-1,3-thiazol-2-imine |
| SMILES | CCCCCn1c(-c2cccc(S(=O)(=O)N3CCCCCC3)c2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C26H33N3O2S2/c1-2-3-9-19-29-25(21-32-26(29)27-23-14-7-6-8-15-23)22-13-12-16-24(20-22)33(30,31)28-17-10-4-5-11-18-28/h6-8,12-16,20-21H,2-5,9-11,17-19H2,1H3/b27-26- |
| InChIKey | QCKWDWLZYLFSJZ-RQZHXJHFSA-N |
| XLogP | 6.20 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|