C24H29N3O2S2 — CID 40971293
4-[3-[(3R)-3-methylpiperidin-1-yl]sulfonylphenyl]-N-phenyl-3-propyl-1,3-thiazol-2-imine (PubChem CID 40971293) has the molecular formula C24H29N3O2S2 and a molecular weight of 455.65 g/mol. Its IUPAC name is 4-[3-[(3R)-3-methylpiperidin-1-yl]sulfonylphenyl]-N-phenyl-3-propyl-1,3-thiazol-2-imine.
| Compound Name | 4-[3-[(3R)-3-methylpiperidin-1-yl]sulfonylphenyl]-N-phenyl-3-propyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 40971293 |
| Molecular Formula | C24H29N3O2S2 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 4-[3-[(3R)-3-methylpiperidin-1-yl]sulfonylphenyl]-N-phenyl-3-propyl-1,3-thiazol-2-imine |
| SMILES | CCCn1c(-c2cccc(S(=O)(=O)N3CCC[C@@H](C)C3)c2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C24H29N3O2S2/c1-3-14-27-23(18-30-24(27)25-21-11-5-4-6-12-21)20-10-7-13-22(16-20)31(28,29)26-15-8-9-19(2)17-26/h4-7,10-13,16,18-19H,3,8-9,14-15,17H2,1-2H3/b25-24-/t19-/m1/s1 |
| InChIKey | JIEGXKFPMREPLK-KRXRYSOXSA-N |
| XLogP | 5.28 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|