C27H27N3O2S2 — CID 4701350
4-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-N,3-diphenyl-1,3-thiazol-2-imine (PubChem CID 4701350) has the molecular formula C27H27N3O2S2 and a molecular weight of 489.67 g/mol. Its IUPAC name is 4-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-N,3-diphenyl-1,3-thiazol-2-imine.
| Compound Name | 4-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-N,3-diphenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4701350 |
| Molecular Formula | C27H27N3O2S2 |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 4-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-N,3-diphenyl-1,3-thiazol-2-imine |
| SMILES | CC1CCN(S(=O)(=O)c2cccc(-c3cs/c(=N\c4ccccc4)n3-c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C27H27N3O2S2/c1-21-15-17-29(18-16-21)34(31,32)25-14-8-9-22(19-25)26-20-33-27(28-23-10-4-2-5-11-23)30(26)24-12-6-3-7-13-24/h2-14,19-21H,15-18H2,1H3/b28-27- |
| InChIKey | KDTPGLIOHXPWES-DQSJHHFOSA-N |
| XLogP | 5.86 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|