C25H31N3O3S2 — CID 41003331
4-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-methoxyethyl)-N-phenyl-1,3-thiazol-2-imine (PubChem CID 41003331) has the molecular formula C25H31N3O3S2 and a molecular weight of 485.68 g/mol. Its IUPAC name is 4-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-methoxyethyl)-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 4-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-methoxyethyl)-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 41003331 |
| Molecular Formula | C25H31N3O3S2 |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 4-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-methoxyethyl)-N-phenyl-1,3-thiazol-2-imine |
| SMILES | COCCn1c(-c2cccc(S(=O)(=O)N3C[C@H](C)C[C@@H](C)C3)c2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C25H31N3O3S2/c1-19-14-20(2)17-27(16-19)33(29,30)23-11-7-8-21(15-23)24-18-32-25(28(24)12-13-31-3)26-22-9-5-4-6-10-22/h4-11,15,18-20H,12-14,16-17H2,1-3H3/b26-25-/t19-,20-/m1/s1 |
| InChIKey | PICHAMXMIPMZMB-WOBINFATSA-N |
| XLogP | 4.76 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|