C24H29N3O3S2 — CID 3415659
3-(2-methoxyethyl)-4-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-N-phenyl-1,3-thiazol-2-imine (PubChem CID 3415659) has the molecular formula C24H29N3O3S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-4-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 3-(2-methoxyethyl)-4-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 3415659 |
| Molecular Formula | C24H29N3O3S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 3-(2-methoxyethyl)-4-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-N-phenyl-1,3-thiazol-2-imine |
| SMILES | COCCn1c(-c2cccc(S(=O)(=O)N3CCCC(C)C3)c2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C24H29N3O3S2/c1-19-8-7-13-26(17-19)32(28,29)22-12-6-9-20(16-22)23-18-31-24(27(23)14-15-30-2)25-21-10-4-3-5-11-21/h3-6,9-12,16,18-19H,7-8,13-15,17H2,1-2H3/b25-24- |
| InChIKey | BJJZSZOGXZFELI-IZHYLOQSSA-N |
| XLogP | 4.52 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|