C27H34N4O4S2 — CID 4233270
4-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-3-(2-morpholin-4-ylethyl)-N-phenyl-1,3-thiazol-2-imine (PubChem CID 4233270) has the molecular formula C27H34N4O4S2 and a molecular weight of 542.73 g/mol. Its IUPAC name is 4-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-3-(2-morpholin-4-ylethyl)-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 4-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-3-(2-morpholin-4-ylethyl)-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4233270 |
| Molecular Formula | C27H34N4O4S2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 4-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-3-(2-morpholin-4-ylethyl)-N-phenyl-1,3-thiazol-2-imine |
| SMILES | CC1CN(S(=O)(=O)c2cccc(-c3cs/c(=N\c4ccccc4)n3CCN3CCOCC3)c2)CC(C)O1 |
| InChI | InChI=1S/C27H34N4O4S2/c1-21-18-30(19-22(2)35-21)37(32,33)25-10-6-7-23(17-25)26-20-36-27(28-24-8-4-3-5-9-24)31(26)12-11-29-13-15-34-16-14-29/h3-10,17,20-22H,11-16,18-19H2,1-2H3/b28-27- |
| InChIKey | QWGVQHIMRFGPTJ-DQSJHHFOSA-N |
| XLogP | 3.58 |
| TPSA | 76.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|