C26H33N3O3S2 — CID 40999736
4-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]-3-pentyl-N-phenyl-1,3-thiazol-2-imine (PubChem CID 40999736) has the molecular formula C26H33N3O3S2 and a molecular weight of 499.70 g/mol. Its IUPAC name is 4-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]-3-pentyl-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 4-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]-3-pentyl-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 40999736 |
| Molecular Formula | C26H33N3O3S2 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 4-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]-3-pentyl-N-phenyl-1,3-thiazol-2-imine |
| SMILES | CCCCCn1c(-c2cccc(S(=O)(=O)N3C[C@H](C)O[C@@H](C)C3)c2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C26H33N3O3S2/c1-4-5-9-15-29-25(19-33-26(29)27-23-12-7-6-8-13-23)22-11-10-14-24(16-22)34(30,31)28-17-20(2)32-21(3)18-28/h6-8,10-14,16,19-21H,4-5,9,15,17-18H2,1-3H3/b27-26-/t20-,21-/m0/s1 |
| InChIKey | BKUIWLCDDUIDQA-KBJWBXEOSA-N |
| XLogP | 5.44 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|