C28H36N4O3S2 — CID 98185144
4-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-morpholin-4-ylethyl)-N-phenyl-1,3-thiazol-2-imine (PubChem CID 98185144) has the molecular formula C28H36N4O3S2 and a molecular weight of 540.76 g/mol. Its IUPAC name is 4-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-morpholin-4-ylethyl)-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 4-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-morpholin-4-ylethyl)-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 98185144 |
| Molecular Formula | C28H36N4O3S2 |
| Molecular Weight | 540.76 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 4-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-morpholin-4-ylethyl)-N-phenyl-1,3-thiazol-2-imine |
| SMILES | C[C@H]1C[C@H](C)CN(S(=O)(=O)c2cccc(-c3cs/c(=N\c4ccccc4)n3CCN3CCOCC3)c2)C1 |
| InChI | InChI=1S/C28H36N4O3S2/c1-22-17-23(2)20-31(19-22)37(33,34)26-10-6-7-24(18-26)27-21-36-28(29-25-8-4-3-5-9-25)32(27)12-11-30-13-15-35-16-14-30/h3-10,18,21-23H,11-17,19-20H2,1-2H3/b29-28-/t22-,23-/m0/s1 |
| InChIKey | IIOMUPPGLPLANA-MYJZRRDVSA-N |
| XLogP | 4.45 |
| TPSA | 67.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.76 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|