C27H27N3O3S2 — CID 4701371
3-[(4-methylphenyl)methyl]-4-(3-morpholin-4-ylsulfonylphenyl)-N-phenyl-1,3-thiazol-2-imine (PubChem CID 4701371) has the molecular formula C27H27N3O3S2 and a molecular weight of 505.67 g/mol. Its IUPAC name is 3-[(4-methylphenyl)methyl]-4-(3-morpholin-4-ylsulfonylphenyl)-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 3-[(4-methylphenyl)methyl]-4-(3-morpholin-4-ylsulfonylphenyl)-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4701371 |
| Molecular Formula | C27H27N3O3S2 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 3-[(4-methylphenyl)methyl]-4-(3-morpholin-4-ylsulfonylphenyl)-N-phenyl-1,3-thiazol-2-imine |
| SMILES | Cc1ccc(Cn2c(-c3cccc(S(=O)(=O)N4CCOCC4)c3)cs/c2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C27H27N3O3S2/c1-21-10-12-22(13-11-21)19-30-26(20-34-27(30)28-24-7-3-2-4-8-24)23-6-5-9-25(18-23)35(31,32)29-14-16-33-17-15-29/h2-13,18,20H,14-17,19H2,1H3/b28-27- |
| InChIKey | SNSJIWXDSRCLPJ-DQSJHHFOSA-N |
| XLogP | 4.83 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|