C28H29N3O4S2 — CID 1017711
3-[(4-methoxyphenyl)methyl]-N-(3-methylphenyl)-4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine (PubChem CID 1017711) has the molecular formula C28H29N3O4S2 and a molecular weight of 535.69 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-N-(3-methylphenyl)-4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-N-(3-methylphenyl)-4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 1017711 |
| Molecular Formula | C28H29N3O4S2 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-N-(3-methylphenyl)-4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(Cn2c(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)cs/c2=N\c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C28H29N3O4S2/c1-21-4-3-5-24(18-21)29-28-31(19-22-6-10-25(34-2)11-7-22)27(20-36-28)23-8-12-26(13-9-23)37(32,33)30-14-16-35-17-15-30/h3-13,18,20H,14-17,19H2,1-2H3/b29-28- |
| InChIKey | RMJCQRBIVBHQKO-ZIADKAODSA-N |
| XLogP | 4.84 |
| TPSA | 73.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|