C23H27N3O2S — CID 138392716
4-(3-methoxyphenyl)-N-(3-methylphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine (PubChem CID 138392716) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-N-(3-methylphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(3-methoxyphenyl)-N-(3-methylphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 138392716 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 4-(3-methoxyphenyl)-N-(3-methylphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine |
| SMILES | COc1cccc(-c2cs/c(=N\c3cccc(C)c3)n2CCN2CCOCC2)c1 |
| InChI | InChI=1S/C23H27N3O2S/c1-18-5-3-7-20(15-18)24-23-26(10-9-25-11-13-28-14-12-25)22(17-29-23)19-6-4-8-21(16-19)27-2/h3-8,15-17H,9-14H2,1-2H3/b24-23- |
| InChIKey | GOGZCWDNCPXZHH-VHXPQNKSSA-N |
| XLogP | 4.10 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|