C22H24ClN3OS — CID 138392708
4-(4-chlorophenyl)-N-(3-methylphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine (PubChem CID 138392708) has the molecular formula C22H24ClN3OS and a molecular weight of 413.97 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(3-methylphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(4-chlorophenyl)-N-(3-methylphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 138392708 |
| Molecular Formula | C22H24ClN3OS |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(3-methylphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine |
| SMILES | Cc1cccc(/N=c2\scc(-c3ccc(Cl)cc3)n2CCN2CCOCC2)c1 |
| InChI | InChI=1S/C22H24ClN3OS/c1-17-3-2-4-20(15-17)24-22-26(10-9-25-11-13-27-14-12-25)21(16-28-22)18-5-7-19(23)8-6-18/h2-8,15-16H,9-14H2,1H3/b24-22- |
| InChIKey | YDCLWOQMGVPCHM-GYHWCHFESA-N |
| XLogP | 4.74 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|