C23H27N3OS — CID 138392682
N-(2-methylphenyl)-4-(4-methylphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine (PubChem CID 138392682) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is N-(2-methylphenyl)-4-(4-methylphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine.
| Compound Name | N-(2-methylphenyl)-4-(4-methylphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 138392682 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-(2-methylphenyl)-4-(4-methylphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine |
| SMILES | Cc1ccc(-c2cs/c(=N\c3ccccc3C)n2CCN2CCOCC2)cc1 |
| InChI | InChI=1S/C23H27N3OS/c1-18-7-9-20(10-8-18)22-17-28-23(24-21-6-4-3-5-19(21)2)26(22)12-11-25-13-15-27-16-14-25/h3-10,17H,11-16H2,1-2H3/b24-23- |
| InChIKey | LJXKTGNXUGFBEW-VHXPQNKSSA-N |
| XLogP | 4.40 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|