C27H33N3OS — CID 138392669
4-(4-cyclohexylphenyl)-3-(2-morpholin-4-ylethyl)-N-phenyl-1,3-thiazol-2-imine (PubChem CID 138392669) has the molecular formula C27H33N3OS and a molecular weight of 447.65 g/mol. Its IUPAC name is 4-(4-cyclohexylphenyl)-3-(2-morpholin-4-ylethyl)-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 4-(4-cyclohexylphenyl)-3-(2-morpholin-4-ylethyl)-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 138392669 |
| Molecular Formula | C27H33N3OS |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 4-(4-cyclohexylphenyl)-3-(2-morpholin-4-ylethyl)-N-phenyl-1,3-thiazol-2-imine |
| SMILES | c1ccc(/N=c2\scc(-c3ccc(C4CCCCC4)cc3)n2CCN2CCOCC2)cc1 |
| InChI | InChI=1S/C27H33N3OS/c1-3-7-22(8-4-1)23-11-13-24(14-12-23)26-21-32-27(28-25-9-5-2-6-10-25)30(26)16-15-29-17-19-31-20-18-29/h2,5-6,9-14,21-22H,1,3-4,7-8,15-20H2/b28-27- |
| InChIKey | HZZPTMGMMWYALQ-DQSJHHFOSA-N |
| XLogP | 5.83 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|