C31H34N2OS — CID 138392853
4-(4-cyclohexylphenyl)-N-(4-ethoxyphenyl)-3-(2-phenylethyl)-1,3-thiazol-2-imine (PubChem CID 138392853) has the molecular formula C31H34N2OS and a molecular weight of 482.69 g/mol. Its IUPAC name is 4-(4-cyclohexylphenyl)-N-(4-ethoxyphenyl)-3-(2-phenylethyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(4-cyclohexylphenyl)-N-(4-ethoxyphenyl)-3-(2-phenylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 138392853 |
| Molecular Formula | C31H34N2OS |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 4-(4-cyclohexylphenyl)-N-(4-ethoxyphenyl)-3-(2-phenylethyl)-1,3-thiazol-2-imine |
| SMILES | CCOc1ccc(/N=c2\scc(-c3ccc(C4CCCCC4)cc3)n2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H34N2OS/c1-2-34-29-19-17-28(18-20-29)32-31-33(22-21-24-9-5-3-6-10-24)30(23-35-31)27-15-13-26(14-16-27)25-11-7-4-8-12-25/h3,5-6,9-10,13-20,23,25H,2,4,7-8,11-12,21-22H2,1H3/b32-31- |
| InChIKey | KKKAPBBVSZDDFM-MVJHLKBCSA-N |
| XLogP | 8.14 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|