C23H20N2OS — CID 44761853
3-(2-phenoxyethyl)-N,4-diphenyl-1,3-thiazol-2-imine (PubChem CID 44761853) has the molecular formula C23H20N2OS and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-(2-phenoxyethyl)-N,4-diphenyl-1,3-thiazol-2-imine.
| Compound Name | 3-(2-phenoxyethyl)-N,4-diphenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 44761853 |
| Molecular Formula | C23H20N2OS |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 3-(2-phenoxyethyl)-N,4-diphenyl-1,3-thiazol-2-imine |
| SMILES | c1ccc(/N=c2\scc(-c3ccccc3)n2CCOc2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2OS/c1-4-10-19(11-5-1)22-18-27-23(24-20-12-6-2-7-13-20)25(22)16-17-26-21-14-8-3-9-15-21/h1-15,18H,16-17H2/b24-23- |
| InChIKey | WHHSHJQVEVHTKR-VHXPQNKSSA-N |
| XLogP | 5.53 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|