C19H20N2OS — CID 4996936
2-[4-(4-ethylphenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol (PubChem CID 4996936) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is 2-[4-(4-ethylphenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol.
| Compound Name | 2-[4-(4-ethylphenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 4996936 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-[4-(4-ethylphenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol |
| SMILES | CCc1ccc(-c2cs/c(=N\c3ccccc3)n2CCO)cc1 |
| InChI | InChI=1S/C19H20N2OS/c1-2-15-8-10-16(11-9-15)18-14-23-19(21(18)12-13-22)20-17-6-4-3-5-7-17/h3-11,14,22H,2,12-13H2,1H3/b20-19- |
| InChIKey | XFDGMOWBKKUBDL-VXPUYCOJSA-N |
| XLogP | 4.00 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|