C23H20BrClN2OS — CID 163332772
2-[2-(3-chlorophenyl)imino-4-(4-phenylphenyl)-1,3-thiazol-3-yl]ethanol;hydrobromide (PubChem CID 163332772) has the molecular formula C23H20BrClN2OS and a molecular weight of 487.85 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)imino-4-(4-phenylphenyl)-1,3-thiazol-3-yl]ethanol;hydrobromide.
| Compound Name | 2-[2-(3-chlorophenyl)imino-4-(4-phenylphenyl)-1,3-thiazol-3-yl]ethanol;hydrobromide |
|---|---|
| PubChem CID | 163332772 |
| Molecular Formula | C23H20BrClN2OS |
| Molecular Weight | 487.85 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 2-[2-(3-chlorophenyl)imino-4-(4-phenylphenyl)-1,3-thiazol-3-yl]ethanol;hydrobromide |
| SMILES | Br.OCCn1c(-c2ccc(-c3ccccc3)cc2)cs/c1=N\c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H19ClN2OS.BrH/c24-20-7-4-8-21(15-20)25-23-26(13-14-27)22(16-28-23)19-11-9-18(10-12-19)17-5-2-1-3-6-17;/h1-12,15-16,27H,13-14H2;1H/b25-23-; |
| InChIKey | ROUUFIWXHRRPKI-ADYMNVQMSA-N |
| XLogP | 6.34 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.85 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|