C21H23ClN2OS — CID 138392602
2-[4-(4-tert-butylphenyl)-2-(4-chlorophenyl)imino-1,3-thiazol-3-yl]ethanol (PubChem CID 138392602) has the molecular formula C21H23ClN2OS and a molecular weight of 386.95 g/mol. Its IUPAC name is 2-[4-(4-tert-butylphenyl)-2-(4-chlorophenyl)imino-1,3-thiazol-3-yl]ethanol.
| Compound Name | 2-[4-(4-tert-butylphenyl)-2-(4-chlorophenyl)imino-1,3-thiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 138392602 |
| Molecular Formula | C21H23ClN2OS |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-[4-(4-tert-butylphenyl)-2-(4-chlorophenyl)imino-1,3-thiazol-3-yl]ethanol |
| SMILES | CC(C)(C)c1ccc(-c2cs/c(=N\c3ccc(Cl)cc3)n2CCO)cc1 |
| InChI | InChI=1S/C21H23ClN2OS/c1-21(2,3)16-6-4-15(5-7-16)19-14-26-20(24(19)12-13-25)23-18-10-8-17(22)9-11-18/h4-11,14,25H,12-13H2,1-3H3/b23-20- |
| InChIKey | FTAYQRVERVAAHC-ATJXCDBQSA-N |
| XLogP | 5.39 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|