C17H15BrCl2N2S — CID 45125365
N,4-bis(4-chlorophenyl)-3-ethyl-1,3-thiazol-2-imine;hydrobromide (PubChem CID 45125365) has the molecular formula C17H15BrCl2N2S and a molecular weight of 430.20 g/mol. Its IUPAC name is N,4-bis(4-chlorophenyl)-3-ethyl-1,3-thiazol-2-imine;hydrobromide.
| Compound Name | N,4-bis(4-chlorophenyl)-3-ethyl-1,3-thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 45125365 |
| Molecular Formula | C17H15BrCl2N2S |
| Molecular Weight | 430.20 g/mol |
| Exact Mass | 427.95 |
| IUPAC Name | N,4-bis(4-chlorophenyl)-3-ethyl-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.CCn1c(-c2ccc(Cl)cc2)cs/c1=N\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2N2S.BrH/c1-2-21-16(12-3-5-13(18)6-4-12)11-22-17(21)20-15-9-7-14(19)8-10-15;/h3-11H,2H2,1H3;1H/b20-17-; |
| InChIKey | COFJDWMAOZKXEH-BZHDPTRRSA-N |
| XLogP | 6.35 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.20 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|