C19H20N2S — CID 584019
N-(3,4-dimethylphenyl)-3-ethyl-4-phenyl-1,3-thiazol-2-imine (PubChem CID 584019) has the molecular formula C19H20N2S and a molecular weight of 308.45 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-3-ethyl-4-phenyl-1,3-thiazol-2-imine.
| Compound Name | N-(3,4-dimethylphenyl)-3-ethyl-4-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 584019 |
| Molecular Formula | C19H20N2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-(3,4-dimethylphenyl)-3-ethyl-4-phenyl-1,3-thiazol-2-imine |
| SMILES | CCn1c(-c2ccccc2)cs/c1=N\c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H20N2S/c1-4-21-18(16-8-6-5-7-9-16)13-22-19(21)20-17-11-10-14(2)15(3)12-17/h5-13H,4H2,1-3H3/b20-19- |
| InChIKey | XMLSAKGJHMBODU-VXPUYCOJSA-N |
| XLogP | 5.09 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|