C30H26N4S2 — CID 9498727
4-phenyl-N-[4-[(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)amino]phenyl]-3-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 9498727) has the molecular formula C30H26N4S2 and a molecular weight of 506.70 g/mol. Its IUPAC name is 4-phenyl-N-[4-[(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)amino]phenyl]-3-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 4-phenyl-N-[4-[(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)amino]phenyl]-3-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 9498727 |
| Molecular Formula | C30H26N4S2 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 4-phenyl-N-[4-[(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)amino]phenyl]-3-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CCn1c(-c2ccccc2)cs/c1=N\c1ccc(/N=c2\scc(-c3ccccc3)n2CC=C)cc1 |
| InChI | InChI=1S/C30H26N4S2/c1-3-19-33-27(23-11-7-5-8-12-23)21-35-29(33)31-25-15-17-26(18-16-25)32-30-34(20-4-2)28(22-36-30)24-13-9-6-10-14-24/h3-18,21-22H,1-2,19-20H2/b31-29-,32-30- |
| InChIKey | XVERWOFZUYTJKC-SZDCHMHBSA-N |
| XLogP | 7.58 |
| TPSA | 34.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|