C12H14ClN3S — CID 69206071
(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)hydrazine;hydrochloride (PubChem CID 69206071) has the molecular formula C12H14ClN3S and a molecular weight of 267.79 g/mol. Its IUPAC name is (4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)hydrazine;hydrochloride.
| Compound Name | (4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)hydrazine;hydrochloride |
|---|---|
| PubChem CID | 69206071 |
| Molecular Formula | C12H14ClN3S |
| Molecular Weight | 267.79 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | (4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)hydrazine;hydrochloride |
| SMILES | C=CCn1c(-c2ccccc2)csc1=NN.Cl |
| InChI | InChI=1S/C12H13N3S.ClH/c1-2-8-15-11(9-16-12(15)14-13)10-6-4-3-5-7-10;/h2-7,9H,1,8,13H2;1H |
| InChIKey | NQBLDACGJQHLBN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.79 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|