C16H23ClN6S2 — CID 161182851
1-amino-3-prop-2-enylthiourea;(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)hydrazine;hydrochloride (PubChem CID 161182851) has the molecular formula C16H23ClN6S2 and a molecular weight of 398.99 g/mol. Its IUPAC name is 1-amino-3-prop-2-enylthiourea;(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)hydrazine;hydrochloride.
| Compound Name | 1-amino-3-prop-2-enylthiourea;(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)hydrazine;hydrochloride |
|---|---|
| PubChem CID | 161182851 |
| Molecular Formula | C16H23ClN6S2 |
| Molecular Weight | 398.99 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 1-amino-3-prop-2-enylthiourea;(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)hydrazine;hydrochloride |
| SMILES | C=CCNC(=S)NN.C=CCn1c(-c2ccccc2)csc1=NN.Cl |
| InChI | InChI=1S/C12H13N3S.C4H9N3S.ClH/c1-2-8-15-11(9-16-12(15)14-13)10-6-4-3-5-7-10;1-2-3-6-4(8)7-5;/h2-7,9H,1,8,13H2;2H,1,3,5H2,(H2,6,7,8);1H |
| InChIKey | KBKYILZNZWNJTI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.99 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|