C18H15FN2O2S2 — CID 3258814
4-fluoro-N-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)benzenesulfonamide (PubChem CID 3258814) has the molecular formula C18H15FN2O2S2 and a molecular weight of 374.46 g/mol. Its IUPAC name is 4-fluoro-N-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)benzenesulfonamide.
| Compound Name | 4-fluoro-N-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 3258814 |
| Molecular Formula | C18H15FN2O2S2 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 4-fluoro-N-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)benzenesulfonamide |
| SMILES | C=CCn1c(-c2ccccc2)csc1=NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FN2O2S2/c1-2-12-21-17(14-6-4-3-5-7-14)13-24-18(21)20-25(22,23)16-10-8-15(19)9-11-16/h2-11,13H,1,12H2 |
| InChIKey | LWLOVVTWGYOFAW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|