C24H20N2O2S2 — CID 72581893
N-(4,5-diphenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)benzenesulfonamide (PubChem CID 72581893) has the molecular formula C24H20N2O2S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is N-(4,5-diphenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)benzenesulfonamide.
| Compound Name | N-(4,5-diphenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 72581893 |
| Molecular Formula | C24H20N2O2S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-(4,5-diphenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)benzenesulfonamide |
| SMILES | C=CCn1c(-c2ccccc2)c(-c2ccccc2)sc1=NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O2S2/c1-2-18-26-22(19-12-6-3-7-13-19)23(20-14-8-4-9-15-20)29-24(26)25-30(27,28)21-16-10-5-11-17-21/h2-17H,1,18H2 |
| InChIKey | DIGJBMKIMZNEJS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|