C16H13FN2O2S2 — CID 40849398
N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide (PubChem CID 40849398) has the molecular formula C16H13FN2O2S2 and a molecular weight of 348.42 g/mol. Its IUPAC name is N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide.
| Compound Name | N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 40849398 |
| Molecular Formula | C16H13FN2O2S2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzenesulfonamide |
| SMILES | C=CCn1c(=NS(=O)(=O)c2ccccc2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C16H13FN2O2S2/c1-2-10-19-14-9-8-12(17)11-15(14)22-16(19)18-23(20,21)13-6-4-3-5-7-13/h2-9,11H,1,10H2 |
| InChIKey | MOGGYXDFYQOTDB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|