C17H15FN2O3S2 — CID 16937492
(NZ)-N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide (PubChem CID 16937492) has the molecular formula C17H15FN2O3S2 and a molecular weight of 378.45 g/mol. Its IUPAC name is (NZ)-N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide.
| Compound Name | (NZ)-N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 16937492 |
| Molecular Formula | C17H15FN2O3S2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | (NZ)-N-(6-fluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide |
| SMILES | C=CCn1/c(=N/S(=O)(=O)c2ccc(OC)cc2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C17H15FN2O3S2/c1-3-10-20-15-9-4-12(18)11-16(15)24-17(20)19-25(21,22)14-7-5-13(23-2)6-8-14/h3-9,11H,1,10H2,2H3/b19-17- |
| InChIKey | CLTOBWUOEQXPJA-ZPHPHTNESA-N |
| XLogP | 3.33 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|